C24H21N3O4 — CID 122218167
[(3aR,4R,9aS)-4-(4-nitroanilino)-3,3a,4,9a-tetrahydro-2H-chromeno[2,3-b]pyrrol-1-yl]-phenylmethanone (PubChem CID 122218167) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is [(3aR,4R,9aS)-4-(4-nitroanilino)-3,3a,4,9a-tetrahydro-2H-chromeno[2,3-b]pyrrol-1-yl]-phenylmethanone.
| Compound Name | [(3aR,4R,9aS)-4-(4-nitroanilino)-3,3a,4,9a-tetrahydro-2H-chromeno[2,3-b]pyrrol-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 122218167 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | [(3aR,4R,9aS)-4-(4-nitroanilino)-3,3a,4,9a-tetrahydro-2H-chromeno[2,3-b]pyrrol-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CC[C@@H]2[C@@H](Nc3ccc([N+](=O)[O-])cc3)c3ccccc3O[C@@H]21 |
| InChI | InChI=1S/C24H21N3O4/c28-23(16-6-2-1-3-7-16)26-15-14-20-22(19-8-4-5-9-21(19)31-24(20)26)25-17-10-12-18(13-11-17)27(29)30/h1-13,20,22,24-25H,14-15H2/t20-,22+,24+/m1/s1 |
| InChIKey | XGJKQDPYDNXLFX-SFLYRZDNSA-N |
| XLogP | 4.63 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|