About [3-(4-butylanilino)-2,3-dihydro-1-benzofuran-2-yl]-(4-nitrophenyl)methanone
[3-(4-butylanilino)-2,3-dihydro-1-benzofuran-2-yl]-(4-nitrophenyl)methanone (PubChem CID 23851788) has the molecular formula C25H24N2O4
and a molecular weight of 416.48 g/mol. Its IUPAC name is [3-(4-butylanilino)-2,3-dihydro-1-benzofuran-2-yl]-(4-nitrophenyl)methanone.
Molecular Properties
| Compound Name | [3-(4-butylanilino)-2,3-dihydro-1-benzofuran-2-yl]-(4-nitrophenyl)methanone |
| PubChem CID | 23851788 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | [3-(4-butylanilino)-2,3-dihydro-1-benzofuran-2-yl]-(4-nitrophenyl)methanone |
| SMILES | CCCCc1ccc(NC2c3ccccc3OC2C(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C25H24N2O4/c1-2-3-6-17-9-13-19(14-10-17)26-23-21-7-4-5-8-22(21)31-25(23)24(28)18-11-15-20(16-12-18)27(29)30/h4-5,7-16,23,25-26H,2-3,6H2,1H3 |
| InChIKey | QJGRYDOYDNYMNT-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-(4-butylanilino)-2,3-dihydro-1-benzofuran-2-yl]-(4-nitrophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-butylanilino)-2,3-dihydro-1-benzofuran-2-yl]-(4-nitrophenyl)methanone?
The IUPAC name of [3-(4-butylanilino)-2,3-dihydro-1-benzofuran-2-yl]-(4-nitrophenyl)methanone (CID 23851788) is [3-(4-butylanilino)-2,3-dihydro-1-benzofuran-2-yl]-(4-nitrophenyl)methanone.
What is the SMILES notation for [3-(4-butylanilino)-2,3-dihydro-1-benzofuran-2-yl]-(4-nitrophenyl)methanone?
The canonical SMILES for [3-(4-butylanilino)-2,3-dihydro-1-benzofuran-2-yl]-(4-nitrophenyl)methanone is CCCCc1ccc(NC2c3ccccc3OC2C(=O)c2ccc([N+](=O)[O-])cc2)cc1.
What is the InChIKey of [3-(4-butylanilino)-2,3-dihydro-1-benzofuran-2-yl]-(4-nitrophenyl)methanone?
The InChIKey is QJGRYDOYDNYMNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24N2O4/c1-2-3-6-17-9-13-19(14-10-17)26-23-21-7-4-5-8-22(21)31-25(23)24(28)18-11-15-20(16-12-18)27(29)30/h4-5,7-16,23,25-26H,2-3,6H2,1H3.
What are the key properties of [3-(4-butylanilino)-2,3-dihydro-1-benzofuran-2-yl]-(4-nitrophenyl)methanone?
[3-(4-butylanilino)-2,3-dihydro-1-benzofuran-2-yl]-(4-nitrophenyl)methanone has a molecular weight of 416.48 g/mol, XLogP of 5.73, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-butylanilino)-2,3-dihydro-1-benzofuran-2-yl]-(4-nitrophenyl)methanone is sourced from PubChem (CID 23851788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).