C42H70N4O8 — CID 173432190
bis(N-ethyl-N-[4-(4-nitrophenyl)butyl]octan-1-amine);oxalic acid (PubChem CID 173432190) has the molecular formula C42H70N4O8 and a molecular weight of 759.04 g/mol. Its IUPAC name is bis(N-ethyl-N-[4-(4-nitrophenyl)butyl]octan-1-amine);oxalic acid.
| Compound Name | bis(N-ethyl-N-[4-(4-nitrophenyl)butyl]octan-1-amine);oxalic acid |
|---|---|
| PubChem CID | 173432190 |
| Molecular Formula | C42H70N4O8 |
| Molecular Weight | 759.04 g/mol |
| Exact Mass | 758.52 |
| IUPAC Name | bis(N-ethyl-N-[4-(4-nitrophenyl)butyl]octan-1-amine);oxalic acid |
| SMILES | CCCCCCCCN(CC)CCCCc1ccc([N+](=O)[O-])cc1.CCCCCCCCN(CC)CCCCc1ccc([N+](=O)[O-])cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/2C20H34N2O2.C2H2O4/c2*1-3-5-6-7-8-10-17-21(4-2)18-11-9-12-19-13-15-20(16-14-19)22(23)24;3-1(4)2(5)6/h2*13-16H,3-12,17-18H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | DNJHKSKUJVQARX-UHFFFAOYSA-N |
| XLogP | 10.36 |
| TPSA | 167.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.04 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|