C20H32N2O8 — CID 173432931
2,3-dihydroxybutanedioic acid;N-methyl-N-[4-(4-nitrophenyl)butyl]pentan-1-amine (PubChem CID 173432931) has the molecular formula C20H32N2O8 and a molecular weight of 428.48 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;N-methyl-N-[4-(4-nitrophenyl)butyl]pentan-1-amine.
| Compound Name | 2,3-dihydroxybutanedioic acid;N-methyl-N-[4-(4-nitrophenyl)butyl]pentan-1-amine |
|---|---|
| PubChem CID | 173432931 |
| Molecular Formula | C20H32N2O8 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;N-methyl-N-[4-(4-nitrophenyl)butyl]pentan-1-amine |
| SMILES | CCCCCN(C)CCCCc1ccc([N+](=O)[O-])cc1.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C16H26N2O2.C4H6O6/c1-3-4-6-13-17(2)14-7-5-8-15-9-11-16(12-10-15)18(19)20;5-1(3(7)8)2(6)4(9)10/h9-12H,3-8,13-14H2,1-2H3;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | NVDRSCQIAKTXFC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 161.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|