C35H42BrN3O4 — CID 159001909
N-benzyl-N-ethyl-2-(4-nitrophenyl)ethanamine;1-(2-bromoethyl)-4-nitrobenzene;butylbenzene (PubChem CID 159001909) has the molecular formula C35H42BrN3O4 and a molecular weight of 648.64 g/mol. Its IUPAC name is N-benzyl-N-ethyl-2-(4-nitrophenyl)ethanamine;1-(2-bromoethyl)-4-nitrobenzene;butylbenzene.
| Compound Name | N-benzyl-N-ethyl-2-(4-nitrophenyl)ethanamine;1-(2-bromoethyl)-4-nitrobenzene;butylbenzene |
|---|---|
| PubChem CID | 159001909 |
| Molecular Formula | C35H42BrN3O4 |
| Molecular Weight | 648.64 g/mol |
| Exact Mass | 647.24 |
| IUPAC Name | N-benzyl-N-ethyl-2-(4-nitrophenyl)ethanamine;1-(2-bromoethyl)-4-nitrobenzene;butylbenzene |
| SMILES | CCCCc1ccccc1.CCN(CCc1ccc([N+](=O)[O-])cc1)Cc1ccccc1.O=[N+]([O-])c1ccc(CCBr)cc1 |
| InChI | InChI=1S/C17H20N2O2.C10H14.C8H8BrNO2/c1-2-18(14-16-6-4-3-5-7-16)13-12-15-8-10-17(11-9-15)19(20)21;1-2-3-7-10-8-5-4-6-9-10;9-6-5-7-1-3-8(4-2-7)10(11)12/h3-11H,2,12-14H2,1H3;4-6,8-9H,2-3,7H2,1H3;1-4H,5-6H2 |
| InChIKey | JRLCHNJQZHMIDU-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.64 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|