C21H34N2O6 — CID 173395187
N-ethyl-N-(4-nitro-4-phenylbutyl)heptan-1-amine;oxalic acid (PubChem CID 173395187) has the molecular formula C21H34N2O6 and a molecular weight of 410.51 g/mol. Its IUPAC name is N-ethyl-N-(4-nitro-4-phenylbutyl)heptan-1-amine;oxalic acid.
| Compound Name | N-ethyl-N-(4-nitro-4-phenylbutyl)heptan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 173395187 |
| Molecular Formula | C21H34N2O6 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | N-ethyl-N-(4-nitro-4-phenylbutyl)heptan-1-amine;oxalic acid |
| SMILES | CCCCCCCN(CC)CCCC(c1ccccc1)[N+](=O)[O-].O=C(O)C(=O)O |
| InChI | InChI=1S/C19H32N2O2.C2H2O4/c1-3-5-6-7-11-16-20(4-2)17-12-15-19(21(22)23)18-13-9-8-10-14-18;3-1(4)2(5)6/h8-10,13-14,19H,3-7,11-12,15-17H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | UVWPGBQCJAQECH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 120.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|