C23H38N2O4 — CID 91298274
1,9-dinitroheptadecylbenzene (PubChem CID 91298274) has the molecular formula C23H38N2O4 and a molecular weight of 406.57 g/mol. Its IUPAC name is 1,9-dinitroheptadecylbenzene.
| Compound Name | 1,9-dinitroheptadecylbenzene |
|---|---|
| PubChem CID | 91298274 |
| Molecular Formula | C23H38N2O4 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.28 |
| IUPAC Name | 1,9-dinitroheptadecylbenzene |
| SMILES | CCCCCCCCC(CCCCCCCC(c1ccccc1)[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C23H38N2O4/c1-2-3-4-5-7-13-18-22(24(26)27)19-14-8-6-9-15-20-23(25(28)29)21-16-11-10-12-17-21/h10-12,16-17,22-23H,2-9,13-15,18-20H2,1H3 |
| InChIKey | MKPQCYXKHIZXQP-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|