C17H32N2 — CID 175350280
N,N-diethylpentan-1-amine;1-phenylethanamine (PubChem CID 175350280) has the molecular formula C17H32N2 and a molecular weight of 264.46 g/mol. Its IUPAC name is N,N-diethylpentan-1-amine;1-phenylethanamine.
| Compound Name | N,N-diethylpentan-1-amine;1-phenylethanamine |
|---|---|
| PubChem CID | 175350280 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | N,N-diethylpentan-1-amine;1-phenylethanamine |
| SMILES | CC(N)c1ccccc1.CCCCCN(CC)CC |
| InChI | InChI=1S/C9H21N.C8H11N/c1-4-7-8-9-10(5-2)6-3;1-7(9)8-5-3-2-4-6-8/h4-9H2,1-3H3;2-7H,9H2,1H3 |
| InChIKey | WQULJZOONSTVMI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|