C13H23N3 — CID 146614516
N'-[amino(phenyl)methyl]-N'-butylethane-1,2-diamine (PubChem CID 146614516) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is N'-[amino(phenyl)methyl]-N'-butylethane-1,2-diamine.
| Compound Name | N'-[amino(phenyl)methyl]-N'-butylethane-1,2-diamine |
|---|---|
| PubChem CID | 146614516 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | N'-[amino(phenyl)methyl]-N'-butylethane-1,2-diamine |
| SMILES | CCCCN(CCN)C(N)c1ccccc1 |
| InChI | InChI=1S/C13H23N3/c1-2-3-10-16(11-9-14)13(15)12-7-5-4-6-8-12/h4-8,13H,2-3,9-11,14-15H2,1H3 |
| InChIKey | NSTMKYVFDJWRGD-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|