C14H22N2 — CID 173045613
N'-(1-phenylprop-2-enyl)-N'-propylethane-1,2-diamine (PubChem CID 173045613) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is N'-(1-phenylprop-2-enyl)-N'-propylethane-1,2-diamine.
| Compound Name | N'-(1-phenylprop-2-enyl)-N'-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 173045613 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | N'-(1-phenylprop-2-enyl)-N'-propylethane-1,2-diamine |
| SMILES | C=CC(c1ccccc1)N(CCC)CCN |
| InChI | InChI=1S/C14H22N2/c1-3-11-16(12-10-15)14(4-2)13-8-6-5-7-9-13/h4-9,14H,2-3,10-12,15H2,1H3 |
| InChIKey | HSTOBQTUNGKFFX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|