C15H22N2 — CID 67917354
N'-(1-phenylethyl)-N'-propylbut-2-yne-1,4-diamine (PubChem CID 67917354) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is N'-(1-phenylethyl)-N'-propylbut-2-yne-1,4-diamine.
| Compound Name | N'-(1-phenylethyl)-N'-propylbut-2-yne-1,4-diamine |
|---|---|
| PubChem CID | 67917354 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | N'-(1-phenylethyl)-N'-propylbut-2-yne-1,4-diamine |
| SMILES | CCCN(CC#CCN)C(C)c1ccccc1 |
| InChI | InChI=1S/C15H22N2/c1-3-12-17(13-8-7-11-16)14(2)15-9-5-4-6-10-15/h4-6,9-10,14H,3,11-13,16H2,1-2H3 |
| InChIKey | UAMXHDJOCMFWSL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|