C9H12Br2N2 — CID 70448519
N',N'-bis(bromomethyl)-1-phenylmethanediamine (PubChem CID 70448519) has the molecular formula C9H12Br2N2 and a molecular weight of 308.02 g/mol. Its IUPAC name is N',N'-bis(bromomethyl)-1-phenylmethanediamine.
| Compound Name | N',N'-bis(bromomethyl)-1-phenylmethanediamine |
|---|---|
| PubChem CID | 70448519 |
| Molecular Formula | C9H12Br2N2 |
| Molecular Weight | 308.02 g/mol |
| Exact Mass | 305.94 |
| IUPAC Name | N',N'-bis(bromomethyl)-1-phenylmethanediamine |
| SMILES | NC(c1ccccc1)N(CBr)CBr |
| InChI | InChI=1S/C9H12Br2N2/c10-6-13(7-11)9(12)8-4-2-1-3-5-8/h1-5,9H,6-7,12H2 |
| InChIKey | XRWJWDRIUKNYFL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.02 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|