About bromo(phenyl)methanamine;hydroiodide
bromo(phenyl)methanamine;hydroiodide (PubChem CID 175393432) has the molecular formula C7H9BrIN
and a molecular weight of 313.96 g/mol. Its IUPAC name is bromo(phenyl)methanamine;hydroiodide.
Molecular Properties
| Compound Name | bromo(phenyl)methanamine;hydroiodide |
| PubChem CID | 175393432 |
| Molecular Formula | C7H9BrIN |
| Molecular Weight | 313.96 g/mol |
| Exact Mass | 312.90 |
| IUPAC Name | bromo(phenyl)methanamine;hydroiodide |
| SMILES | I.NC(Br)c1ccccc1 |
| InChI | InChI=1S/C7H8BrN.HI/c8-7(9)6-4-2-1-3-5-6;/h1-5,7H,9H2;1H |
| InChIKey | STOLMJRBGVTRSU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.96 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze bromo(phenyl)methanamine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromo(phenyl)methanamine;hydroiodide?
The IUPAC name of bromo(phenyl)methanamine;hydroiodide (CID 175393432) is bromo(phenyl)methanamine;hydroiodide.
What is the SMILES notation for bromo(phenyl)methanamine;hydroiodide?
The canonical SMILES for bromo(phenyl)methanamine;hydroiodide is I.NC(Br)c1ccccc1.
What is the InChIKey of bromo(phenyl)methanamine;hydroiodide?
The InChIKey is STOLMJRBGVTRSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8BrN.HI/c8-7(9)6-4-2-1-3-5-6;/h1-5,7H,9H2;1H.
What are the key properties of bromo(phenyl)methanamine;hydroiodide?
bromo(phenyl)methanamine;hydroiodide has a molecular weight of 313.96 g/mol, XLogP of 2.66, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bromo(phenyl)methanamine;hydroiodide is sourced from PubChem (CID 175393432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).