About diphenylmethanamine;methanethiol
diphenylmethanamine;methanethiol (PubChem CID 143873840) has the molecular formula C14H17NS
and a molecular weight of 231.36 g/mol. Its IUPAC name is diphenylmethanamine;methanethiol.
Molecular Properties
| Compound Name | diphenylmethanamine;methanethiol |
| PubChem CID | 143873840 |
| Molecular Formula | C14H17NS |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | diphenylmethanamine;methanethiol |
| SMILES | CS.NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H13N.CH4S/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2/h1-10,13H,14H2;2H,1H3 |
| InChIKey | VRRSWQWTUNAGDM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze diphenylmethanamine;methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethanamine;methanethiol?
The IUPAC name of diphenylmethanamine;methanethiol (CID 143873840) is diphenylmethanamine;methanethiol.
What is the SMILES notation for diphenylmethanamine;methanethiol?
The canonical SMILES for diphenylmethanamine;methanethiol is CS.NC(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylmethanamine;methanethiol?
The InChIKey is VRRSWQWTUNAGDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N.CH4S/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2/h1-10,13H,14H2;2H,1H3.
What are the key properties of diphenylmethanamine;methanethiol?
diphenylmethanamine;methanethiol has a molecular weight of 231.36 g/mol, XLogP of 3.28, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanamine;methanethiol is sourced from PubChem (CID 143873840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).