About diphenylmethanamine;phosphoric acid
diphenylmethanamine;phosphoric acid (PubChem CID 67153031) has the molecular formula C13H16NO4P
and a molecular weight of 281.25 g/mol. Its IUPAC name is diphenylmethanamine;phosphoric acid.
Molecular Properties
| Compound Name | diphenylmethanamine;phosphoric acid |
| PubChem CID | 67153031 |
| Molecular Formula | C13H16NO4P |
| Molecular Weight | 281.25 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | diphenylmethanamine;phosphoric acid |
| SMILES | NC(c1ccccc1)c1ccccc1.O=P(O)(O)O |
| InChI | InChI=1S/C13H13N.H3O4P/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-5(2,3)4/h1-10,13H,14H2;(H3,1,2,3,4) |
| InChIKey | GAVVYQPGEHFYCB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenylmethanamine;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethanamine;phosphoric acid?
The IUPAC name of diphenylmethanamine;phosphoric acid (CID 67153031) is diphenylmethanamine;phosphoric acid.
What is the SMILES notation for diphenylmethanamine;phosphoric acid?
The canonical SMILES for diphenylmethanamine;phosphoric acid is NC(c1ccccc1)c1ccccc1.O=P(O)(O)O.
What is the InChIKey of diphenylmethanamine;phosphoric acid?
The InChIKey is GAVVYQPGEHFYCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N.H3O4P/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-5(2,3)4/h1-10,13H,14H2;(H3,1,2,3,4).
What are the key properties of diphenylmethanamine;phosphoric acid?
diphenylmethanamine;phosphoric acid has a molecular weight of 281.25 g/mol, XLogP of 1.81, 2 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanamine;phosphoric acid is sourced from PubChem (CID 67153031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).