About diphenylmethanamine;N-phenylaniline
diphenylmethanamine;N-phenylaniline (PubChem CID 162045655) has the molecular formula C25H24N2
and a molecular weight of 352.48 g/mol. Its IUPAC name is diphenylmethanamine;N-phenylaniline.
Molecular Properties
| Compound Name | diphenylmethanamine;N-phenylaniline |
| PubChem CID | 162045655 |
| Molecular Formula | C25H24N2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | diphenylmethanamine;N-phenylaniline |
| SMILES | NC(c1ccccc1)c1ccccc1.c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C13H13N.C12H11N/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10,13H,14H2;1-10,13H |
| InChIKey | YXVUKGUHHYZJAS-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze diphenylmethanamine;N-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethanamine;N-phenylaniline?
The IUPAC name of diphenylmethanamine;N-phenylaniline (CID 162045655) is diphenylmethanamine;N-phenylaniline.
What is the SMILES notation for diphenylmethanamine;N-phenylaniline?
The canonical SMILES for diphenylmethanamine;N-phenylaniline is NC(c1ccccc1)c1ccccc1.c1ccc(Nc2ccccc2)cc1.
What is the InChIKey of diphenylmethanamine;N-phenylaniline?
The InChIKey is YXVUKGUHHYZJAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N.C12H11N/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10,13H,14H2;1-10,13H.
What are the key properties of diphenylmethanamine;N-phenylaniline?
diphenylmethanamine;N-phenylaniline has a molecular weight of 352.48 g/mol, XLogP of 6.16, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanamine;N-phenylaniline is sourced from PubChem (CID 162045655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).