About cumene;N-phenylaniline
cumene;N-phenylaniline (PubChem CID 22645781) has the molecular formula C21H23N
and a molecular weight of 289.42 g/mol. Its IUPAC name is cumene;N-phenylaniline.
Molecular Properties
| Compound Name | cumene;N-phenylaniline |
| PubChem CID | 22645781 |
| Molecular Formula | C21H23N |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | cumene;N-phenylaniline |
| SMILES | CC(C)c1ccccc1.c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11N.C9H12/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-8(2)9-6-4-3-5-7-9/h1-10,13H;3-8H,1-2H3 |
| InChIKey | CDWUWABZNKTLJY-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cumene;N-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cumene;N-phenylaniline?
The IUPAC name of cumene;N-phenylaniline (CID 22645781) is cumene;N-phenylaniline.
What is the SMILES notation for cumene;N-phenylaniline?
The canonical SMILES for cumene;N-phenylaniline is CC(C)c1ccccc1.c1ccc(Nc2ccccc2)cc1.
What is the InChIKey of cumene;N-phenylaniline?
The InChIKey is CDWUWABZNKTLJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N.C9H12/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-8(2)9-6-4-3-5-7-9/h1-10,13H;3-8H,1-2H3.
What are the key properties of cumene;N-phenylaniline?
cumene;N-phenylaniline has a molecular weight of 289.42 g/mol, XLogP of 6.24, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cumene;N-phenylaniline is sourced from PubChem (CID 22645781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).