C24H28N2 — CID 71359938
1-N,4-N-bis(4-propan-2-ylphenyl)benzene-1,4-diamine (PubChem CID 71359938) has the molecular formula C24H28N2 and a molecular weight of 344.50 g/mol. Its IUPAC name is 1-N,4-N-bis(4-propan-2-ylphenyl)benzene-1,4-diamine.
| Compound Name | 1-N,4-N-bis(4-propan-2-ylphenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 71359938 |
| Molecular Formula | C24H28N2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | 1-N,4-N-bis(4-propan-2-ylphenyl)benzene-1,4-diamine |
| SMILES | CC(C)c1ccc(Nc2ccc(Nc3ccc(C(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H28N2/c1-17(2)19-5-9-21(10-6-19)25-23-13-15-24(16-14-23)26-22-11-7-20(8-12-22)18(3)4/h5-18,25-26H,1-4H3 |
| InChIKey | NAKOADASVKRCOD-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |