C9H12BrNO — CID 10988050
(2R,3S)-2-amino-3-bromo-3-phenylpropan-1-ol (PubChem CID 10988050) has the molecular formula C9H12BrNO and a molecular weight of 230.11 g/mol. Its IUPAC name is (2R,3S)-2-amino-3-bromo-3-phenylpropan-1-ol.
| Compound Name | (2R,3S)-2-amino-3-bromo-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 10988050 |
| Molecular Formula | C9H12BrNO |
| Molecular Weight | 230.11 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | (2R,3S)-2-amino-3-bromo-3-phenylpropan-1-ol |
| SMILES | N[C@H](CO)[C@@H](Br)c1ccccc1 |
| InChI | InChI=1S/C9H12BrNO/c10-9(8(11)6-12)7-4-2-1-3-5-7/h1-5,8-9,12H,6,11H2/t8-,9+/m1/s1 |
| InChIKey | YBARPXDCHBQNQM-BDAKNGLRSA-N |
| XLogP | 1.44 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.11 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|