C17H20O2 — CID 102125969
(2R,3R)-2,3-diphenylpentane-1,5-diol (PubChem CID 102125969) has the molecular formula C17H20O2 and a molecular weight of 256.35 g/mol. Its IUPAC name is (2R,3R)-2,3-diphenylpentane-1,5-diol.
| Compound Name | (2R,3R)-2,3-diphenylpentane-1,5-diol |
|---|---|
| PubChem CID | 102125969 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | (2R,3R)-2,3-diphenylpentane-1,5-diol |
| SMILES | OCC[C@@H](c1ccccc1)[C@@H](CO)c1ccccc1 |
| InChI | InChI=1S/C17H20O2/c18-12-11-16(14-7-3-1-4-8-14)17(13-19)15-9-5-2-6-10-15/h1-10,16-19H,11-13H2/t16-,17-/m0/s1 |
| InChIKey | ACIZQKQWGSKCCO-IRXDYDNUSA-N |
| XLogP | 2.93 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |