C17H19Cl2N — CID 21153300
1,5-dichloro-1,5-diphenylpentan-3-amine (PubChem CID 21153300) has the molecular formula C17H19Cl2N and a molecular weight of 308.25 g/mol. Its IUPAC name is 1,5-dichloro-1,5-diphenylpentan-3-amine.
| Compound Name | 1,5-dichloro-1,5-diphenylpentan-3-amine |
|---|---|
| PubChem CID | 21153300 |
| Molecular Formula | C17H19Cl2N |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 1,5-dichloro-1,5-diphenylpentan-3-amine |
| SMILES | NC(CC(Cl)c1ccccc1)CC(Cl)c1ccccc1 |
| InChI | InChI=1S/C17H19Cl2N/c18-16(13-7-3-1-4-8-13)11-15(20)12-17(19)14-9-5-2-6-10-14/h1-10,15-17H,11-12,20H2 |
| InChIKey | BEPCDLFQROHJIY-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|