About dichloromethylbenzene
dichloromethylbenzene (PubChem CID 7411) has the molecular formula C7H6Cl2
and a molecular weight of 161.03 g/mol. Its IUPAC name is dichloromethylbenzene.
Molecular Properties
| Compound Name | dichloromethylbenzene |
| PubChem CID | 7411 |
| Molecular Formula | C7H6Cl2 |
| Molecular Weight | 161.03 g/mol |
| Exact Mass | 159.98 |
| IUPAC Name | dichloromethylbenzene |
| SMILES | ClC(Cl)c1ccccc1 |
| InChI | InChI=1S/C7H6Cl2/c8-7(9)6-4-2-1-3-5-6/h1-5,7H |
| InChIKey | CAHQGWAXKLQREW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.03 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze dichloromethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethylbenzene?
The IUPAC name of dichloromethylbenzene (CID 7411) is dichloromethylbenzene.
What is the SMILES notation for dichloromethylbenzene?
The canonical SMILES for dichloromethylbenzene is ClC(Cl)c1ccccc1.
What is the InChIKey of dichloromethylbenzene?
The InChIKey is CAHQGWAXKLQREW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6Cl2/c8-7(9)6-4-2-1-3-5-6/h1-5,7H.
What are the key properties of dichloromethylbenzene?
dichloromethylbenzene has a molecular weight of 161.03 g/mol, XLogP of 3.16, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethylbenzene is sourced from PubChem (CID 7411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).