C14H12BrCl — CID 101135261
[(1S,2R)-1-bromo-2-chloro-2-phenylethyl]benzene (PubChem CID 101135261) has the molecular formula C14H12BrCl and a molecular weight of 295.61 g/mol. Its IUPAC name is [(1S,2R)-1-bromo-2-chloro-2-phenylethyl]benzene.
| Compound Name | [(1S,2R)-1-bromo-2-chloro-2-phenylethyl]benzene |
|---|---|
| PubChem CID | 101135261 |
| Molecular Formula | C14H12BrCl |
| Molecular Weight | 295.61 g/mol |
| Exact Mass | 293.98 |
| IUPAC Name | [(1S,2R)-1-bromo-2-chloro-2-phenylethyl]benzene |
| SMILES | Cl[C@H](c1ccccc1)[C@@H](Br)c1ccccc1 |
| InChI | InChI=1S/C14H12BrCl/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-14H/t13-,14+/m0/s1 |
| InChIKey | OKPMTEQLJZGUFR-UONOGXRCSA-N |
| XLogP | 5.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.61 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|