C18H18Br4O — CID 174279741
[1,2-dibromo-3-(2,3-dibromo-3-phenylpropoxy)propyl]benzene (PubChem CID 174279741) has the molecular formula C18H18Br4O and a molecular weight of 569.96 g/mol. Its IUPAC name is [1,2-dibromo-3-(2,3-dibromo-3-phenylpropoxy)propyl]benzene.
| Compound Name | [1,2-dibromo-3-(2,3-dibromo-3-phenylpropoxy)propyl]benzene |
|---|---|
| PubChem CID | 174279741 |
| Molecular Formula | C18H18Br4O |
| Molecular Weight | 569.96 g/mol |
| Exact Mass | 565.81 |
| IUPAC Name | [1,2-dibromo-3-(2,3-dibromo-3-phenylpropoxy)propyl]benzene |
| SMILES | BrC(COCC(Br)C(Br)c1ccccc1)C(Br)c1ccccc1 |
| InChI | InChI=1S/C18H18Br4O/c19-15(17(21)13-7-3-1-4-8-13)11-23-12-16(20)18(22)14-9-5-2-6-10-14/h1-10,15-18H,11-12H2 |
| InChIKey | UQZKGPIGYIVAPA-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.96 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|