C10H13BrO2 — CID 129364228
[(1R)-1-bromo-2,2-dimethoxyethyl]benzene (PubChem CID 129364228) has the molecular formula C10H13BrO2 and a molecular weight of 245.12 g/mol. Its IUPAC name is [(1R)-1-bromo-2,2-dimethoxyethyl]benzene.
| Compound Name | [(1R)-1-bromo-2,2-dimethoxyethyl]benzene |
|---|---|
| PubChem CID | 129364228 |
| Molecular Formula | C10H13BrO2 |
| Molecular Weight | 245.12 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | [(1R)-1-bromo-2,2-dimethoxyethyl]benzene |
| SMILES | COC(OC)[C@H](Br)c1ccccc1 |
| InChI | InChI=1S/C10H13BrO2/c1-12-10(13-2)9(11)8-6-4-3-5-7-8/h3-7,9-10H,1-2H3/t9-/m1/s1 |
| InChIKey | BYCZMBJMRZGEDH-SECBINFHSA-N |
| XLogP | 2.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.12 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|