About dichloromethylbenzene;ethene
dichloromethylbenzene;ethene (PubChem CID 157063786) has the molecular formula C9H10Cl2
and a molecular weight of 189.08 g/mol. Its IUPAC name is dichloromethylbenzene;ethene.
Molecular Properties
| Compound Name | dichloromethylbenzene;ethene |
| PubChem CID | 157063786 |
| Molecular Formula | C9H10Cl2 |
| Molecular Weight | 189.08 g/mol |
| Exact Mass | 188.02 |
| IUPAC Name | dichloromethylbenzene;ethene |
| SMILES | C=C.ClC(Cl)c1ccccc1 |
| InChI | InChI=1S/C7H6Cl2.C2H4/c8-7(9)6-4-2-1-3-5-6;1-2/h1-5,7H;1-2H2 |
| InChIKey | ABQCQSTWZIQXCT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.08 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dichloromethylbenzene;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethylbenzene;ethene?
The IUPAC name of dichloromethylbenzene;ethene (CID 157063786) is dichloromethylbenzene;ethene.
What is the SMILES notation for dichloromethylbenzene;ethene?
The canonical SMILES for dichloromethylbenzene;ethene is C=C.ClC(Cl)c1ccccc1.
What is the InChIKey of dichloromethylbenzene;ethene?
The InChIKey is ABQCQSTWZIQXCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6Cl2.C2H4/c8-7(9)6-4-2-1-3-5-6;1-2/h1-5,7H;1-2H2.
What are the key properties of dichloromethylbenzene;ethene?
dichloromethylbenzene;ethene has a molecular weight of 189.08 g/mol, XLogP of 3.96, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethylbenzene;ethene is sourced from PubChem (CID 157063786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).