C18H14N4O3 — CID 102460072
6-(4-nitroanilino)-5,6-dihydro-1,10-phenanthrolin-5-ol (PubChem CID 102460072) has the molecular formula C18H14N4O3 and a molecular weight of 334.34 g/mol. Its IUPAC name is 6-(4-nitroanilino)-5,6-dihydro-1,10-phenanthrolin-5-ol.
| Compound Name | 6-(4-nitroanilino)-5,6-dihydro-1,10-phenanthrolin-5-ol |
|---|---|
| PubChem CID | 102460072 |
| Molecular Formula | C18H14N4O3 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 6-(4-nitroanilino)-5,6-dihydro-1,10-phenanthrolin-5-ol |
| SMILES | O=[N+]([O-])c1ccc(NC2c3cccnc3-c3ncccc3C2O)cc1 |
| InChI | InChI=1S/C18H14N4O3/c23-18-14-4-2-10-20-16(14)15-13(3-1-9-19-15)17(18)21-11-5-7-12(8-6-11)22(24)25/h1-10,17-18,21,23H |
| InChIKey | XRYRCAQBJIWSBN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 101.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|