C22H20N2O5 — CID 132532763
methyl 6-benzyl-1-(4-nitrophenyl)-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazine-8-carboxylate (PubChem CID 132532763) has the molecular formula C22H20N2O5 and a molecular weight of 392.41 g/mol. Its IUPAC name is methyl 6-benzyl-1-(4-nitrophenyl)-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazine-8-carboxylate.
| Compound Name | methyl 6-benzyl-1-(4-nitrophenyl)-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazine-8-carboxylate |
|---|---|
| PubChem CID | 132532763 |
| Molecular Formula | C22H20N2O5 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | methyl 6-benzyl-1-(4-nitrophenyl)-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazine-8-carboxylate |
| SMILES | COC(=O)c1cc(Cc2ccccc2)n2c1C(c1ccc([N+](=O)[O-])cc1)OCC2 |
| InChI | InChI=1S/C22H20N2O5/c1-28-22(25)19-14-18(13-15-5-3-2-4-6-15)23-11-12-29-21(20(19)23)16-7-9-17(10-8-16)24(26)27/h2-10,14,21H,11-13H2,1H3 |
| InChIKey | VFDDOYMGGBINSC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 83.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|