C24H20N2O4 — CID 135067794
methyl (3R)-1-(4-nitrophenyl)-2,3-diphenyl-2,3-dihydropyrrole-5-carboxylate (PubChem CID 135067794) has the molecular formula C24H20N2O4 and a molecular weight of 400.43 g/mol. Its IUPAC name is methyl (3R)-1-(4-nitrophenyl)-2,3-diphenyl-2,3-dihydropyrrole-5-carboxylate.
| Compound Name | methyl (3R)-1-(4-nitrophenyl)-2,3-diphenyl-2,3-dihydropyrrole-5-carboxylate |
|---|---|
| PubChem CID | 135067794 |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | methyl (3R)-1-(4-nitrophenyl)-2,3-diphenyl-2,3-dihydropyrrole-5-carboxylate |
| SMILES | COC(=O)C1=C[C@H](c2ccccc2)C(c2ccccc2)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H20N2O4/c1-30-24(27)22-16-21(17-8-4-2-5-9-17)23(18-10-6-3-7-11-18)25(22)19-12-14-20(15-13-19)26(28)29/h2-16,21,23H,1H3/t21-,23?/m1/s1 |
| InChIKey | BCSSVBITPFNMLL-FKHAVUOCSA-N |
| XLogP | 5.00 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|