C26H22N2O4 — CID 101159427
methyl (4S,5R)-1-(4-nitrophenyl)-4,5-diphenyl-4,5-dihydroazepine-2-carboxylate (PubChem CID 101159427) has the molecular formula C26H22N2O4 and a molecular weight of 426.47 g/mol. Its IUPAC name is methyl (4S,5R)-1-(4-nitrophenyl)-4,5-diphenyl-4,5-dihydroazepine-2-carboxylate.
| Compound Name | methyl (4S,5R)-1-(4-nitrophenyl)-4,5-diphenyl-4,5-dihydroazepine-2-carboxylate |
|---|---|
| PubChem CID | 101159427 |
| Molecular Formula | C26H22N2O4 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | methyl (4S,5R)-1-(4-nitrophenyl)-4,5-diphenyl-4,5-dihydroazepine-2-carboxylate |
| SMILES | COC(=O)C1=C[C@@H](c2ccccc2)[C@@H](c2ccccc2)C=CN1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H22N2O4/c1-32-26(29)25-18-24(20-10-6-3-7-11-20)23(19-8-4-2-5-9-19)16-17-27(25)21-12-14-22(15-13-21)28(30)31/h2-18,23-24H,1H3/t23-,24+/m1/s1 |
| InChIKey | MREPKEQOVDWLGP-RPWUZVMVSA-N |
| XLogP | 5.55 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|