C21H21NO2 — CID 102526319
methyl 2-methyl-1-(4-methylphenyl)-4-phenyl-4H-pyridine-3-carboxylate (PubChem CID 102526319) has the molecular formula C21H21NO2 and a molecular weight of 319.40 g/mol. Its IUPAC name is methyl 2-methyl-1-(4-methylphenyl)-4-phenyl-4H-pyridine-3-carboxylate.
| Compound Name | methyl 2-methyl-1-(4-methylphenyl)-4-phenyl-4H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 102526319 |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | methyl 2-methyl-1-(4-methylphenyl)-4-phenyl-4H-pyridine-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2ccc(C)cc2)C=CC1c1ccccc1 |
| InChI | InChI=1S/C21H21NO2/c1-15-9-11-18(12-10-15)22-14-13-19(17-7-5-4-6-8-17)20(16(22)2)21(23)24-3/h4-14,19H,1-3H3 |
| InChIKey | UFNLVQZYVLZNJK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |