C16H17NO4 — CID 134933594
dimethyl 4-(4-methylphenyl)-4H-pyridine-1,3-dicarboxylate (PubChem CID 134933594) has the molecular formula C16H17NO4 and a molecular weight of 287.32 g/mol. Its IUPAC name is dimethyl 4-(4-methylphenyl)-4H-pyridine-1,3-dicarboxylate.
| Compound Name | dimethyl 4-(4-methylphenyl)-4H-pyridine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 134933594 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | dimethyl 4-(4-methylphenyl)-4H-pyridine-1,3-dicarboxylate |
| SMILES | COC(=O)C1=CN(C(=O)OC)C=CC1c1ccc(C)cc1 |
| InChI | InChI=1S/C16H17NO4/c1-11-4-6-12(7-5-11)13-8-9-17(16(19)21-3)10-14(13)15(18)20-2/h4-10,13H,1-3H3 |
| InChIKey | AISQQAFJGZQCAA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |