C21H29NO2 — CID 102046008
ethyl 1-hexyl-2-methyl-4-phenyl-4H-pyridine-3-carboxylate (PubChem CID 102046008) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is ethyl 1-hexyl-2-methyl-4-phenyl-4H-pyridine-3-carboxylate.
| Compound Name | ethyl 1-hexyl-2-methyl-4-phenyl-4H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 102046008 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | ethyl 1-hexyl-2-methyl-4-phenyl-4H-pyridine-3-carboxylate |
| SMILES | CCCCCCN1C=CC(c2ccccc2)C(C(=O)OCC)=C1C |
| InChI | InChI=1S/C21H29NO2/c1-4-6-7-11-15-22-16-14-19(18-12-9-8-10-13-18)20(17(22)3)21(23)24-5-2/h8-10,12-14,16,19H,4-7,11,15H2,1-3H3 |
| InChIKey | IWNNPWOPJGBYRU-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|