C24H36O2S — CID 10644011
ethyl 4-octyl-5-phenyl-2-propan-2-yl-2,5-dihydrothiophene-3-carboxylate (PubChem CID 10644011) has the molecular formula C24H36O2S and a molecular weight of 388.62 g/mol. Its IUPAC name is ethyl 4-octyl-5-phenyl-2-propan-2-yl-2,5-dihydrothiophene-3-carboxylate.
| Compound Name | ethyl 4-octyl-5-phenyl-2-propan-2-yl-2,5-dihydrothiophene-3-carboxylate |
|---|---|
| PubChem CID | 10644011 |
| Molecular Formula | C24H36O2S |
| Molecular Weight | 388.62 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | ethyl 4-octyl-5-phenyl-2-propan-2-yl-2,5-dihydrothiophene-3-carboxylate |
| SMILES | CCCCCCCCC1=C(C(=O)OCC)C(C(C)C)SC1c1ccccc1 |
| InChI | InChI=1S/C24H36O2S/c1-5-7-8-9-10-14-17-20-21(24(25)26-6-2)22(18(3)4)27-23(20)19-15-12-11-13-16-19/h11-13,15-16,18,22-23H,5-10,14,17H2,1-4H3 |
| InChIKey | BTQRNCFZQBYZNV-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.62 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|