C17H21IO3 — CID 101207654
ethyl (2R,3R)-2-(iodomethyl)-3-phenyl-5-propan-2-yl-2,3-dihydrofuran-4-carboxylate (PubChem CID 101207654) has the molecular formula C17H21IO3 and a molecular weight of 400.26 g/mol. Its IUPAC name is ethyl (2R,3R)-2-(iodomethyl)-3-phenyl-5-propan-2-yl-2,3-dihydrofuran-4-carboxylate.
| Compound Name | ethyl (2R,3R)-2-(iodomethyl)-3-phenyl-5-propan-2-yl-2,3-dihydrofuran-4-carboxylate |
|---|---|
| PubChem CID | 101207654 |
| Molecular Formula | C17H21IO3 |
| Molecular Weight | 400.26 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | ethyl (2R,3R)-2-(iodomethyl)-3-phenyl-5-propan-2-yl-2,3-dihydrofuran-4-carboxylate |
| SMILES | CCOC(=O)C1=C(C(C)C)O[C@@H](CI)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H21IO3/c1-4-20-17(19)15-14(12-8-6-5-7-9-12)13(10-18)21-16(15)11(2)3/h5-9,11,13-14H,4,10H2,1-3H3/t13-,14-/m0/s1 |
| InChIKey | OAQOTNGJPZYJET-KBPBESRZSA-N |
| XLogP | 4.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.26 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|