C24H19IO2 — CID 101207650
[(2S,3R)-2-(iodomethyl)-3,5-diphenyl-2,3-dihydrofuran-4-yl]-phenylmethanone (PubChem CID 101207650) has the molecular formula C24H19IO2 and a molecular weight of 466.32 g/mol. Its IUPAC name is [(2S,3R)-2-(iodomethyl)-3,5-diphenyl-2,3-dihydrofuran-4-yl]-phenylmethanone.
| Compound Name | [(2S,3R)-2-(iodomethyl)-3,5-diphenyl-2,3-dihydrofuran-4-yl]-phenylmethanone |
|---|---|
| PubChem CID | 101207650 |
| Molecular Formula | C24H19IO2 |
| Molecular Weight | 466.32 g/mol |
| Exact Mass | 466.04 |
| IUPAC Name | [(2S,3R)-2-(iodomethyl)-3,5-diphenyl-2,3-dihydrofuran-4-yl]-phenylmethanone |
| SMILES | O=C(C1=C(c2ccccc2)O[C@H](CI)[C@@H]1c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H19IO2/c25-16-20-21(17-10-4-1-5-11-17)22(23(26)18-12-6-2-7-13-18)24(27-20)19-14-8-3-9-15-19/h1-15,20-21H,16H2/t20-,21+/m1/s1 |
| InChIKey | NRQFJQRFJMFPMC-RTWAWAEBSA-N |
| XLogP | 5.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.32 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|