C17H10O4 — CID 11680721
4-benzoyl-5-phenyl(2,3-13C2)furan-2,3-dione (PubChem CID 11680721) has the molecular formula C17H10O4 and a molecular weight of 280.25 g/mol. Its IUPAC name is 4-benzoyl-5-phenyl(2,3-13C2)furan-2,3-dione.
| Compound Name | 4-benzoyl-5-phenyl(2,3-13C2)furan-2,3-dione |
|---|---|
| PubChem CID | 11680721 |
| Molecular Formula | C17H10O4 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 4-benzoyl-5-phenyl(2,3-13C2)furan-2,3-dione |
| SMILES | O=C(C1=C(c2ccccc2)O[13C](=O)[13C]1=O)c1ccccc1 |
| InChI | InChI=1S/C17H10O4/c18-14(11-7-3-1-4-8-11)13-15(19)17(20)21-16(13)12-9-5-2-6-10-12/h1-10H/i15+1,17+1 |
| InChIKey | JSNKUVWINRORKZ-YSNSLIITSA-N |
| XLogP | 2.41 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_fives(89)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|