C18H15NO3 — CID 10946294
4-benzoyl-5-phenyl-2,3-dihydrofuran-2-carboxamide (PubChem CID 10946294) has the molecular formula C18H15NO3 and a molecular weight of 293.32 g/mol. Its IUPAC name is 4-benzoyl-5-phenyl-2,3-dihydrofuran-2-carboxamide.
| Compound Name | 4-benzoyl-5-phenyl-2,3-dihydrofuran-2-carboxamide |
|---|---|
| PubChem CID | 10946294 |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 4-benzoyl-5-phenyl-2,3-dihydrofuran-2-carboxamide |
| SMILES | NC(=O)C1CC(C(=O)c2ccccc2)=C(c2ccccc2)O1 |
| InChI | InChI=1S/C18H15NO3/c19-18(21)15-11-14(16(20)12-7-3-1-4-8-12)17(22-15)13-9-5-2-6-10-13/h1-10,15H,11H2,(H2,19,21) |
| InChIKey | SYPPUIZFNATUDQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |