C25H18N2O2 — CID 2140571
(4R)-2-amino-5-benzoyl-4,6-diphenyl-4H-pyran-3-carbonitrile (PubChem CID 2140571) has the molecular formula C25H18N2O2 and a molecular weight of 378.43 g/mol. Its IUPAC name is (4R)-2-amino-5-benzoyl-4,6-diphenyl-4H-pyran-3-carbonitrile.
| Compound Name | (4R)-2-amino-5-benzoyl-4,6-diphenyl-4H-pyran-3-carbonitrile |
|---|---|
| PubChem CID | 2140571 |
| Molecular Formula | C25H18N2O2 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | (4R)-2-amino-5-benzoyl-4,6-diphenyl-4H-pyran-3-carbonitrile |
| SMILES | N#CC1=C(N)OC(c2ccccc2)=C(C(=O)c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C25H18N2O2/c26-16-20-21(17-10-4-1-5-11-17)22(23(28)18-12-6-2-7-13-18)24(29-25(20)27)19-14-8-3-9-15-19/h1-15,21H,27H2/t21-/m1/s1 |
| InChIKey | QXZDPKFQUMXTIV-OAQYLSRUSA-N |
| XLogP | 4.79 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |