C16H14N2O4 — CID 122691161
3-(5-acetyl-2-amino-3-cyano-6-methyl-4H-pyran-4-yl)benzoic acid (PubChem CID 122691161) has the molecular formula C16H14N2O4 and a molecular weight of 298.30 g/mol. Its IUPAC name is 3-(5-acetyl-2-amino-3-cyano-6-methyl-4H-pyran-4-yl)benzoic acid.
| Compound Name | 3-(5-acetyl-2-amino-3-cyano-6-methyl-4H-pyran-4-yl)benzoic acid |
|---|---|
| PubChem CID | 122691161 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 3-(5-acetyl-2-amino-3-cyano-6-methyl-4H-pyran-4-yl)benzoic acid |
| SMILES | CC(=O)C1=C(C)OC(N)=C(C#N)C1c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C16H14N2O4/c1-8(19)13-9(2)22-15(18)12(7-17)14(13)10-4-3-5-11(6-10)16(20)21/h3-6,14H,18H2,1-2H3,(H,20,21) |
| InChIKey | HMOCCVKWOKRCKQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |