C15H12N4O2 — CID 135297049
6-(5-acetyl-2-amino-3-cyano-6-methyl-4H-pyran-4-yl)pyridine-2-carbonitrile (PubChem CID 135297049) has the molecular formula C15H12N4O2 and a molecular weight of 280.29 g/mol. Its IUPAC name is 6-(5-acetyl-2-amino-3-cyano-6-methyl-4H-pyran-4-yl)pyridine-2-carbonitrile.
| Compound Name | 6-(5-acetyl-2-amino-3-cyano-6-methyl-4H-pyran-4-yl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 135297049 |
| Molecular Formula | C15H12N4O2 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 6-(5-acetyl-2-amino-3-cyano-6-methyl-4H-pyran-4-yl)pyridine-2-carbonitrile |
| SMILES | CC(=O)C1=C(C)OC(N)=C(C#N)C1c1cccc(C#N)n1 |
| InChI | InChI=1S/C15H12N4O2/c1-8(20)13-9(2)21-15(18)11(7-17)14(13)12-5-3-4-10(6-16)19-12/h3-5,14H,18H2,1-2H3 |
| InChIKey | BTTZYHAUPJSMHQ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 112.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |