C15H13BrN2O2 — CID 8610749
(4R)-5-acetyl-2-amino-4-(2-bromophenyl)-6-methyl-4H-pyran-3-carbonitrile (PubChem CID 8610749) has the molecular formula C15H13BrN2O2 and a molecular weight of 333.19 g/mol. Its IUPAC name is (4R)-5-acetyl-2-amino-4-(2-bromophenyl)-6-methyl-4H-pyran-3-carbonitrile.
| Compound Name | (4R)-5-acetyl-2-amino-4-(2-bromophenyl)-6-methyl-4H-pyran-3-carbonitrile |
|---|---|
| PubChem CID | 8610749 |
| Molecular Formula | C15H13BrN2O2 |
| Molecular Weight | 333.19 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | (4R)-5-acetyl-2-amino-4-(2-bromophenyl)-6-methyl-4H-pyran-3-carbonitrile |
| SMILES | CC(=O)C1=C(C)OC(N)=C(C#N)[C@H]1c1ccccc1Br |
| InChI | InChI=1S/C15H13BrN2O2/c1-8(19)13-9(2)20-15(18)11(7-17)14(13)10-5-3-4-6-12(10)16/h3-6,14H,18H2,1-2H3/t14-/m1/s1 |
| InChIKey | USTUOVNILBZRLL-CQSZACIVSA-N |
| XLogP | 3.12 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.19 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |