C17H18BrNO4 — CID 8613813
ethyl (4S)-5-acetyl-2-amino-4-(2-bromophenyl)-6-methyl-4H-pyran-3-carboxylate (PubChem CID 8613813) has the molecular formula C17H18BrNO4 and a molecular weight of 380.24 g/mol. Its IUPAC name is ethyl (4S)-5-acetyl-2-amino-4-(2-bromophenyl)-6-methyl-4H-pyran-3-carboxylate.
| Compound Name | ethyl (4S)-5-acetyl-2-amino-4-(2-bromophenyl)-6-methyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 8613813 |
| Molecular Formula | C17H18BrNO4 |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | ethyl (4S)-5-acetyl-2-amino-4-(2-bromophenyl)-6-methyl-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(N)OC(C)=C(C(C)=O)[C@@H]1c1ccccc1Br |
| InChI | InChI=1S/C17H18BrNO4/c1-4-22-17(21)15-14(11-7-5-6-8-12(11)18)13(9(2)20)10(3)23-16(15)19/h5-8,14H,4,19H2,1-3H3/t14-/m0/s1 |
| InChIKey | CKOOKWXPMHXSLF-AWEZNQCLSA-N |
| XLogP | 3.16 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |