C18H20BrNO5 — CID 8613834
ethyl (4R)-5-acetyl-2-amino-4-(5-bromo-2-methoxyphenyl)-6-methyl-4H-pyran-3-carboxylate (PubChem CID 8613834) has the molecular formula C18H20BrNO5 and a molecular weight of 410.26 g/mol. Its IUPAC name is ethyl (4R)-5-acetyl-2-amino-4-(5-bromo-2-methoxyphenyl)-6-methyl-4H-pyran-3-carboxylate.
| Compound Name | ethyl (4R)-5-acetyl-2-amino-4-(5-bromo-2-methoxyphenyl)-6-methyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 8613834 |
| Molecular Formula | C18H20BrNO5 |
| Molecular Weight | 410.26 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | ethyl (4R)-5-acetyl-2-amino-4-(5-bromo-2-methoxyphenyl)-6-methyl-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(N)OC(C)=C(C(C)=O)[C@H]1c1cc(Br)ccc1OC |
| InChI | InChI=1S/C18H20BrNO5/c1-5-24-18(22)16-15(12-8-11(19)6-7-13(12)23-4)14(9(2)21)10(3)25-17(16)20/h6-8,15H,5,20H2,1-4H3/t15-/m1/s1 |
| InChIKey | XFTPLIHUJOGSEH-OAHLLOKOSA-N |
| XLogP | 3.17 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.26 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |