C17H19BN2O6 — CID 169390451
[3-(2-amino-3-cyano-5-ethoxycarbonyl-6-methyl-4H-pyran-4-yl)-4-methoxyphenyl]boronic acid (PubChem CID 169390451) has the molecular formula C17H19BN2O6 and a molecular weight of 358.16 g/mol. Its IUPAC name is [3-(2-amino-3-cyano-5-ethoxycarbonyl-6-methyl-4H-pyran-4-yl)-4-methoxyphenyl]boronic acid.
| Compound Name | [3-(2-amino-3-cyano-5-ethoxycarbonyl-6-methyl-4H-pyran-4-yl)-4-methoxyphenyl]boronic acid |
|---|---|
| PubChem CID | 169390451 |
| Molecular Formula | C17H19BN2O6 |
| Molecular Weight | 358.16 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | [3-(2-amino-3-cyano-5-ethoxycarbonyl-6-methyl-4H-pyran-4-yl)-4-methoxyphenyl]boronic acid |
| SMILES | CCOC(=O)C1=C(C)OC(N)=C(C#N)C1c1cc(B(O)O)ccc1OC |
| InChI | InChI=1S/C17H19BN2O6/c1-4-25-17(21)14-9(2)26-16(20)12(8-19)15(14)11-7-10(18(22)23)5-6-13(11)24-3/h5-7,15,22-23H,4,20H2,1-3H3 |
| InChIKey | AKHPKOSIWADAGI-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 135.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.16 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|