C18H21BN2O6 — CID 169391418
[3-(2-amino-3-cyano-5-ethoxycarbonyl-6-methyl-4H-pyran-4-yl)-5-ethoxyphenyl]boronic acid (PubChem CID 169391418) has the molecular formula C18H21BN2O6 and a molecular weight of 372.19 g/mol. Its IUPAC name is [3-(2-amino-3-cyano-5-ethoxycarbonyl-6-methyl-4H-pyran-4-yl)-5-ethoxyphenyl]boronic acid.
| Compound Name | [3-(2-amino-3-cyano-5-ethoxycarbonyl-6-methyl-4H-pyran-4-yl)-5-ethoxyphenyl]boronic acid |
|---|---|
| PubChem CID | 169391418 |
| Molecular Formula | C18H21BN2O6 |
| Molecular Weight | 372.19 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | [3-(2-amino-3-cyano-5-ethoxycarbonyl-6-methyl-4H-pyran-4-yl)-5-ethoxyphenyl]boronic acid |
| SMILES | CCOC(=O)C1=C(C)OC(N)=C(C#N)C1c1cc(OCC)cc(B(O)O)c1 |
| InChI | InChI=1S/C18H21BN2O6/c1-4-25-13-7-11(6-12(8-13)19(23)24)16-14(9-20)17(21)27-10(3)15(16)18(22)26-5-2/h6-8,16,23-24H,4-5,21H2,1-3H3 |
| InChIKey | MBOZUMZMLHGLGX-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 135.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.19 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|