C28H25N3O3 — CID 169390332
ethyl 6-amino-5-cyano-2-methyl-4-[4-(N-phenylanilino)phenyl]-4H-pyran-3-carboxylate (PubChem CID 169390332) has the molecular formula C28H25N3O3 and a molecular weight of 451.53 g/mol. Its IUPAC name is ethyl 6-amino-5-cyano-2-methyl-4-[4-(N-phenylanilino)phenyl]-4H-pyran-3-carboxylate.
| Compound Name | ethyl 6-amino-5-cyano-2-methyl-4-[4-(N-phenylanilino)phenyl]-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 169390332 |
| Molecular Formula | C28H25N3O3 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | ethyl 6-amino-5-cyano-2-methyl-4-[4-(N-phenylanilino)phenyl]-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)OC(N)=C(C#N)C1c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H25N3O3/c1-3-33-28(32)25-19(2)34-27(30)24(18-29)26(25)20-14-16-23(17-15-20)31(21-10-6-4-7-11-21)22-12-8-5-9-13-22/h4-17,26H,3,30H2,1-2H3 |
| InChIKey | GYFMAKXUQIGWSJ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 88.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |