C15H13FN2O3 — CID 682282
methyl (4R)-6-amino-5-cyano-4-(2-fluorophenyl)-2-methyl-4H-pyran-3-carboxylate (PubChem CID 682282) has the molecular formula C15H13FN2O3 and a molecular weight of 288.28 g/mol. Its IUPAC name is methyl (4R)-6-amino-5-cyano-4-(2-fluorophenyl)-2-methyl-4H-pyran-3-carboxylate.
| Compound Name | methyl (4R)-6-amino-5-cyano-4-(2-fluorophenyl)-2-methyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 682282 |
| Molecular Formula | C15H13FN2O3 |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | methyl (4R)-6-amino-5-cyano-4-(2-fluorophenyl)-2-methyl-4H-pyran-3-carboxylate |
| SMILES | COC(=O)C1=C(C)OC(N)=C(C#N)[C@H]1c1ccccc1F |
| InChI | InChI=1S/C15H13FN2O3/c1-8-12(15(19)20-2)13(10(7-17)14(18)21-8)9-5-3-4-6-11(9)16/h3-6,13H,18H2,1-2H3/t13-/m1/s1 |
| InChIKey | YSNQZZQVKXCHQI-CYBMUJFWSA-N |
| XLogP | 2.08 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |