C17H15F3N2O3 — CID 7310366
methyl (4R)-6-amino-5-cyano-2-ethyl-4-[2-(trifluoromethyl)phenyl]-4H-pyran-3-carboxylate (PubChem CID 7310366) has the molecular formula C17H15F3N2O3 and a molecular weight of 352.31 g/mol. Its IUPAC name is methyl (4R)-6-amino-5-cyano-2-ethyl-4-[2-(trifluoromethyl)phenyl]-4H-pyran-3-carboxylate.
| Compound Name | methyl (4R)-6-amino-5-cyano-2-ethyl-4-[2-(trifluoromethyl)phenyl]-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 7310366 |
| Molecular Formula | C17H15F3N2O3 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | methyl (4R)-6-amino-5-cyano-2-ethyl-4-[2-(trifluoromethyl)phenyl]-4H-pyran-3-carboxylate |
| SMILES | CCC1=C(C(=O)OC)[C@H](c2ccccc2C(F)(F)F)C(C#N)=C(N)O1 |
| InChI | InChI=1S/C17H15F3N2O3/c1-3-12-14(16(23)24-2)13(10(8-21)15(22)25-12)9-6-4-5-7-11(9)17(18,19)20/h4-7,13H,3,22H2,1-2H3/t13-/m1/s1 |
| InChIKey | MNCHJGRCDFQPER-CYBMUJFWSA-N |
| XLogP | 3.35 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |