C22H17ClN2O5 — CID 92848298
methyl (4R)-6-amino-4-[2-(2-chlorobenzoyl)oxyphenyl]-5-cyano-2-methyl-4H-pyran-3-carboxylate (PubChem CID 92848298) has the molecular formula C22H17ClN2O5 and a molecular weight of 424.84 g/mol. Its IUPAC name is methyl (4R)-6-amino-4-[2-(2-chlorobenzoyl)oxyphenyl]-5-cyano-2-methyl-4H-pyran-3-carboxylate.
| Compound Name | methyl (4R)-6-amino-4-[2-(2-chlorobenzoyl)oxyphenyl]-5-cyano-2-methyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 92848298 |
| Molecular Formula | C22H17ClN2O5 |
| Molecular Weight | 424.84 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | methyl (4R)-6-amino-4-[2-(2-chlorobenzoyl)oxyphenyl]-5-cyano-2-methyl-4H-pyran-3-carboxylate |
| SMILES | COC(=O)C1=C(C)OC(N)=C(C#N)[C@H]1c1ccccc1OC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C22H17ClN2O5/c1-12-18(22(27)28-2)19(15(11-24)20(25)29-12)14-8-4-6-10-17(14)30-21(26)13-7-3-5-9-16(13)23/h3-10,19H,25H2,1-2H3/t19-/m1/s1 |
| InChIKey | YQFXDTMNKDKYQV-LJQANCHMSA-N |
| XLogP | 3.81 |
| TPSA | 111.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.84 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|